3-Pyridinecarboxylic acid, 5-bromo-1,4-dihydro-4-oxo-, methyl ester
Methyl 5-bromo-4-hydroxynicotinate
CAS: 1175512-08-9;1052114-83-6
Molecular Formula: C7H6BrNO3
3-Pyridinecarboxylic acid, 5-bromo-1,4-dihydro-4-oxo-, methyl ester - Names and Identifiers
| Name | Methyl 5-bromo-4-hydroxynicotinate |
| Synonyms | Methyl 5-bromo-4-hydroxynicotinate Methyl 5-broMo-4-hydroxynicotinate 3-Pyridinecarboxylic acid, 5-bromo-1,4-dihydro-4-oxo-, methyl ester |
| CAS | 1175512-08-9 1052114-83-6 |
| InChI | InChI=1S/C7H6BrNO3/c1-12-7(11)4-2-9-3-5(8)6(4)10/h2-3H,1H3,(H,9,10) |
3-Pyridinecarboxylic acid, 5-bromo-1,4-dihydro-4-oxo-, methyl ester - Physico-chemical Properties
| Molecular Formula | C7H6BrNO3 |
| Molar Mass | 232.03 |
| Density | 1.737±0.06 g/cm3(Predicted) |
| Boling Point | 309.2±42.0 °C(Predicted) |
| pKa | 7.45±0.69(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
3-Pyridinecarboxylic acid, 5-bromo-1,4-dihydro-4-oxo-, methyl ester - Introduction
Methyl 5-bromo-4-hydroxypyridine-3-carboxylate, also known as methyl bromopicolinate, is an organic compound. The following is a description of its nature, use, formulation and safety information:
Nature:
1. Appearance: 5-bromo -4-hydroxyl pyridine -3-carboxylic acid methyl ester is colorless or slightly yellow liquid.
2. molecular formula: C≡H≡BrNO₂.
3. Molecular weight: 216.03g/mol.
4. Melting point: about 9 ℃.
5. Boiling point: about 112 ℃.
Use:
1. As a reagent in organic synthesis, it is commonly used in the synthesis of other organic compounds.
2. It is often used to synthesize biologically active molecules in drug research and manufacturing.
Preparation Method:
5-Bromo-4-hydroxypyridine-3-carboxylic acid methyl ester can be prepared by the following method:
4-hydroxypyridine and methyl bromoformate are reacted under appropriate conditions to obtain the target product.
Safety Information:
1. 5-Bromo-4-hydroxypyridine-3-carboxylic acid methyl ester is an organic compound, which has certain danger. It is necessary to strictly abide by the safety operation regulations during operation.
2. avoid inhalation, contact with skin and eyes, use should wear protective gloves, protective glasses and other personal protective equipment.
3. in case of contact or misuse, rinse immediately with plenty of water and seek medical attention as soon as possible.
4. should be stored in a cool, dry, well-ventilated place, away from fire and oxidant.
Nature:
1. Appearance: 5-bromo -4-hydroxyl pyridine -3-carboxylic acid methyl ester is colorless or slightly yellow liquid.
2. molecular formula: C≡H≡BrNO₂.
3. Molecular weight: 216.03g/mol.
4. Melting point: about 9 ℃.
5. Boiling point: about 112 ℃.
Use:
1. As a reagent in organic synthesis, it is commonly used in the synthesis of other organic compounds.
2. It is often used to synthesize biologically active molecules in drug research and manufacturing.
Preparation Method:
5-Bromo-4-hydroxypyridine-3-carboxylic acid methyl ester can be prepared by the following method:
4-hydroxypyridine and methyl bromoformate are reacted under appropriate conditions to obtain the target product.
Safety Information:
1. 5-Bromo-4-hydroxypyridine-3-carboxylic acid methyl ester is an organic compound, which has certain danger. It is necessary to strictly abide by the safety operation regulations during operation.
2. avoid inhalation, contact with skin and eyes, use should wear protective gloves, protective glasses and other personal protective equipment.
3. in case of contact or misuse, rinse immediately with plenty of water and seek medical attention as soon as possible.
4. should be stored in a cool, dry, well-ventilated place, away from fire and oxidant.
Last Update：2024-04-09 02:00:41
Supplier List
Multiple Specifications
Product Name: 5-BroMo-4-hydroxynicotinic acid Visit Supplier Webpage Request for quotationCAS: 1052114-83-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Multiple Specifications
Product Name: 5-BroMo-4-hydroxynicotinic acid Visit Supplier Webpage Request for quotationCAS: 1052114-83-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History